C11H19ClN4OS — CID 19456107
1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-(2-methoxyethyl)-1-methylthiourea (PubChem CID 19456107) has the molecular formula C11H19ClN4OS and a molecular weight of 290.82 g/mol. Its IUPAC name is 1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-(2-methoxyethyl)-1-methylthiourea.
| Compound Name | 1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-(2-methoxyethyl)-1-methylthiourea |
|---|---|
| PubChem CID | 19456107 |
| Molecular Formula | C11H19ClN4OS |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-(2-methoxyethyl)-1-methylthiourea |
| SMILES | CCn1cc(Cl)c(CN(C)C(=S)NCCOC)n1 |
| InChI | InChI=1S/C11H19ClN4OS/c1-4-16-7-9(12)10(14-16)8-15(2)11(18)13-5-6-17-3/h7H,4-6,8H2,1-3H3,(H,13,18) |
| InChIKey | DSBSETIWTKULJT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|