C10H17ClN4OS — CID 19465047
1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(2-methoxyethyl)-1-methylthiourea (PubChem CID 19465047) has the molecular formula C10H17ClN4OS and a molecular weight of 276.79 g/mol. Its IUPAC name is 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(2-methoxyethyl)-1-methylthiourea.
| Compound Name | 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(2-methoxyethyl)-1-methylthiourea |
|---|---|
| PubChem CID | 19465047 |
| Molecular Formula | C10H17ClN4OS |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(2-methoxyethyl)-1-methylthiourea |
| SMILES | COCCNC(=S)N(C)Cc1c(Cl)cnn1C |
| InChI | InChI=1S/C10H17ClN4OS/c1-14(10(17)12-4-5-16-3)7-9-8(11)6-13-15(9)2/h6H,4-5,7H2,1-3H3,(H,12,17) |
| InChIKey | TZTVOBDGFGTIGZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|