C12H22BrN5S — CID 19464874
1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-[3-(dimethylamino)propyl]-1-methylthiourea (PubChem CID 19464874) has the molecular formula C12H22BrN5S and a molecular weight of 348.31 g/mol. Its IUPAC name is 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-[3-(dimethylamino)propyl]-1-methylthiourea.
| Compound Name | 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-[3-(dimethylamino)propyl]-1-methylthiourea |
|---|---|
| PubChem CID | 19464874 |
| Molecular Formula | C12H22BrN5S |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-[3-(dimethylamino)propyl]-1-methylthiourea |
| SMILES | CN(C)CCCNC(=S)N(C)Cc1c(Br)cnn1C |
| InChI | InChI=1S/C12H22BrN5S/c1-16(2)7-5-6-14-12(19)17(3)9-11-10(13)8-15-18(11)4/h8H,5-7,9H2,1-4H3,(H,14,19) |
| InChIKey | PGXXRNIZTHKOHF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|