C19H23BrN6S — CID 19464923
3-(1-benzyl-3,5-dimethylpyrazol-4-yl)-1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-1-methylthiourea (PubChem CID 19464923) has the molecular formula C19H23BrN6S and a molecular weight of 447.41 g/mol. Its IUPAC name is 3-(1-benzyl-3,5-dimethylpyrazol-4-yl)-1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-1-methylthiourea.
| Compound Name | 3-(1-benzyl-3,5-dimethylpyrazol-4-yl)-1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 19464923 |
| Molecular Formula | C19H23BrN6S |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 3-(1-benzyl-3,5-dimethylpyrazol-4-yl)-1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-1-methylthiourea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=S)N(C)Cc1c(Br)cnn1C |
| InChI | InChI=1S/C19H23BrN6S/c1-13-18(14(2)26(23-13)11-15-8-6-5-7-9-15)22-19(27)24(3)12-17-16(20)10-21-25(17)4/h5-10H,11-12H2,1-4H3,(H,22,27) |
| InChIKey | WCAPHGAEVVHRCG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|