C15H19BrN4S — CID 19464930
3-benzyl-1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-1-methylthiourea (PubChem CID 19464930) has the molecular formula C15H19BrN4S and a molecular weight of 367.32 g/mol. Its IUPAC name is 3-benzyl-1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-1-methylthiourea.
| Compound Name | 3-benzyl-1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 19464930 |
| Molecular Formula | C15H19BrN4S |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 3-benzyl-1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-1-methylthiourea |
| SMILES | CCn1ncc(Br)c1CN(C)C(=S)NCc1ccccc1 |
| InChI | InChI=1S/C15H19BrN4S/c1-3-20-14(13(16)10-18-20)11-19(2)15(21)17-9-12-7-5-4-6-8-12/h4-8,10H,3,9,11H2,1-2H3,(H,17,21) |
| InChIKey | GUHBNPVDAUZKRO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|