C16H16Cl2N2S — CID 8785714
3-benzyl-1-[(2,3-dichlorophenyl)methyl]-1-methylthiourea (PubChem CID 8785714) has the molecular formula C16H16Cl2N2S and a molecular weight of 339.29 g/mol. Its IUPAC name is 3-benzyl-1-[(2,3-dichlorophenyl)methyl]-1-methylthiourea.
| Compound Name | 3-benzyl-1-[(2,3-dichlorophenyl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 8785714 |
| Molecular Formula | C16H16Cl2N2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 3-benzyl-1-[(2,3-dichlorophenyl)methyl]-1-methylthiourea |
| SMILES | CN(Cc1cccc(Cl)c1Cl)C(=S)NCc1ccccc1 |
| InChI | InChI=1S/C16H16Cl2N2S/c1-20(11-13-8-5-9-14(17)15(13)18)16(21)19-10-12-6-3-2-4-7-12/h2-9H,10-11H2,1H3,(H,19,21) |
| InChIKey | NKWLSAAQCSYJMM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|