C12H14Cl2N2S — CID 8785757
3-cyclopropyl-1-[(2,3-dichlorophenyl)methyl]-1-methylthiourea (PubChem CID 8785757) has the molecular formula C12H14Cl2N2S and a molecular weight of 289.23 g/mol. Its IUPAC name is 3-cyclopropyl-1-[(2,3-dichlorophenyl)methyl]-1-methylthiourea.
| Compound Name | 3-cyclopropyl-1-[(2,3-dichlorophenyl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 8785757 |
| Molecular Formula | C12H14Cl2N2S |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 3-cyclopropyl-1-[(2,3-dichlorophenyl)methyl]-1-methylthiourea |
| SMILES | CN(Cc1cccc(Cl)c1Cl)C(=S)NC1CC1 |
| InChI | InChI=1S/C12H14Cl2N2S/c1-16(12(17)15-9-5-6-9)7-8-3-2-4-10(13)11(8)14/h2-4,9H,5-7H2,1H3,(H,15,17) |
| InChIKey | BBTSODDJDCTIBF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|