C16H16ClN3S — CID 9174457
3-benzyl-1-[(Z)-(2-chlorophenyl)methylideneamino]-1-methylthiourea (PubChem CID 9174457) has the molecular formula C16H16ClN3S and a molecular weight of 317.85 g/mol. Its IUPAC name is 3-benzyl-1-[(Z)-(2-chlorophenyl)methylideneamino]-1-methylthiourea.
| Compound Name | 3-benzyl-1-[(Z)-(2-chlorophenyl)methylideneamino]-1-methylthiourea |
|---|---|
| PubChem CID | 9174457 |
| Molecular Formula | C16H16ClN3S |
| Molecular Weight | 317.85 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-benzyl-1-[(Z)-(2-chlorophenyl)methylideneamino]-1-methylthiourea |
| SMILES | CN(/N=C\c1ccccc1Cl)C(=S)NCc1ccccc1 |
| InChI | InChI=1S/C16H16ClN3S/c1-20(19-12-14-9-5-6-10-15(14)17)16(21)18-11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3,(H,18,21)/b19-12- |
| InChIKey | UMCDYSHOQZMTKJ-UNOMPAQXSA-N |
| XLogP | 3.68 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.85 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|