C18H21N3S — CID 9174529
3-benzyl-1-[(Z)-(2,5-dimethylphenyl)methylideneamino]-1-methylthiourea (PubChem CID 9174529) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 3-benzyl-1-[(Z)-(2,5-dimethylphenyl)methylideneamino]-1-methylthiourea.
| Compound Name | 3-benzyl-1-[(Z)-(2,5-dimethylphenyl)methylideneamino]-1-methylthiourea |
|---|---|
| PubChem CID | 9174529 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-benzyl-1-[(Z)-(2,5-dimethylphenyl)methylideneamino]-1-methylthiourea |
| SMILES | Cc1ccc(C)c(/C=N\N(C)C(=S)NCc2ccccc2)c1 |
| InChI | InChI=1S/C18H21N3S/c1-14-9-10-15(2)17(11-14)13-20-21(3)18(22)19-12-16-7-5-4-6-8-16/h4-11,13H,12H2,1-3H3,(H,19,22)/b20-13- |
| InChIKey | WIRUJOXZCPMSOA-MOSHPQCFSA-N |
| XLogP | 3.64 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|