C14H17BrN4OS — CID 19327172
1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-3-(2-methoxyphenyl)thiourea (PubChem CID 19327172) has the molecular formula C14H17BrN4OS and a molecular weight of 369.29 g/mol. Its IUPAC name is 1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19327172 |
| Molecular Formula | C14H17BrN4OS |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-3-(2-methoxyphenyl)thiourea |
| SMILES | CCn1ncc(Br)c1CNC(=S)Nc1ccccc1OC |
| InChI | InChI=1S/C14H17BrN4OS/c1-3-19-12(10(15)8-17-19)9-16-14(21)18-11-6-4-5-7-13(11)20-2/h4-8H,3,9H2,1-2H3,(H2,16,18,21) |
| InChIKey | FMWCIKUPRPMZCU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|