C11H19BrN4OS — CID 19464873
1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-(3-methoxypropyl)-1-methylthiourea (PubChem CID 19464873) has the molecular formula C11H19BrN4OS and a molecular weight of 335.27 g/mol. Its IUPAC name is 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-(3-methoxypropyl)-1-methylthiourea.
| Compound Name | 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-(3-methoxypropyl)-1-methylthiourea |
|---|---|
| PubChem CID | 19464873 |
| Molecular Formula | C11H19BrN4OS |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-(3-methoxypropyl)-1-methylthiourea |
| SMILES | COCCCNC(=S)N(C)Cc1c(Br)cnn1C |
| InChI | InChI=1S/C11H19BrN4OS/c1-15(11(18)13-5-4-6-17-3)8-10-9(12)7-14-16(10)2/h7H,4-6,8H2,1-3H3,(H,13,18) |
| InChIKey | JZJBJUJPAPZVNG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|