C13H13Cl3N4S — CID 19465039
1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(2,4-dichlorophenyl)-1-methylthiourea (PubChem CID 19465039) has the molecular formula C13H13Cl3N4S and a molecular weight of 363.70 g/mol. Its IUPAC name is 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(2,4-dichlorophenyl)-1-methylthiourea.
| Compound Name | 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(2,4-dichlorophenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 19465039 |
| Molecular Formula | C13H13Cl3N4S |
| Molecular Weight | 363.70 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-3-(2,4-dichlorophenyl)-1-methylthiourea |
| SMILES | CN(Cc1c(Cl)cnn1C)C(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl3N4S/c1-19(7-12-10(16)6-17-20(12)2)13(21)18-11-4-3-8(14)5-9(11)15/h3-6H,7H2,1-2H3,(H,18,21) |
| InChIKey | MSIOVXIPKAJYIO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.70 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|