C16H21ClN4S — CID 17297540
3-(5-chloro-2-methylphenyl)-1-methyl-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea (PubChem CID 17297540) has the molecular formula C16H21ClN4S and a molecular weight of 336.89 g/mol. Its IUPAC name is 3-(5-chloro-2-methylphenyl)-1-methyl-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 3-(5-chloro-2-methylphenyl)-1-methyl-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 17297540 |
| Molecular Formula | C16H21ClN4S |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-(5-chloro-2-methylphenyl)-1-methyl-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea |
| SMILES | Cc1ccc(Cl)cc1NC(=S)N(C)Cc1c(C)nn(C)c1C |
| InChI | InChI=1S/C16H21ClN4S/c1-10-6-7-13(17)8-15(10)18-16(22)20(4)9-14-11(2)19-21(5)12(14)3/h6-8H,9H2,1-5H3,(H,18,22) |
| InChIKey | NGZJGDLWXAAXDJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|