C17H24N4S — CID 17283343
3-(2,4-dimethylphenyl)-1-methyl-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea (PubChem CID 17283343) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-methyl-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 3-(2,4-dimethylphenyl)-1-methyl-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 17283343 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-methyl-1-[(1,3,5-trimethylpyrazol-4-yl)methyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N(C)Cc2c(C)nn(C)c2C)c(C)c1 |
| InChI | InChI=1S/C17H24N4S/c1-11-7-8-16(12(2)9-11)18-17(22)20(5)10-15-13(3)19-21(6)14(15)4/h7-9H,10H2,1-6H3,(H,18,22) |
| InChIKey | GWTHGUZRVFQSEM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|