C13H14Cl2N4S — CID 19464839
3-(3,4-dichlorophenyl)-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]thiourea (PubChem CID 19464839) has the molecular formula C13H14Cl2N4S and a molecular weight of 329.26 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19464839 |
| Molecular Formula | C13H14Cl2N4S |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]thiourea |
| SMILES | CN(Cc1ccnn1C)C(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2N4S/c1-18(8-10-5-6-16-19(10)2)13(20)17-9-3-4-11(14)12(15)7-9/h3-7H,8H2,1-2H3,(H,17,20) |
| InChIKey | YOMALAWHPRHTNT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|