C11H20N4O — CID 19462474
3-butyl-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]urea (PubChem CID 19462474) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-butyl-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]urea.
| Compound Name | 3-butyl-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 19462474 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-butyl-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]urea |
| SMILES | CCCCNC(=O)N(C)Cc1ccnn1C |
| InChI | InChI=1S/C11H20N4O/c1-4-5-7-12-11(16)14(2)9-10-6-8-13-15(10)3/h6,8H,4-5,7,9H2,1-3H3,(H,12,16) |
| InChIKey | YKNGVEVMHJGETO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|