C12H16BrN5O — CID 19278178
4-bromo-1-ethyl-N-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19278178) has the molecular formula C12H16BrN5O and a molecular weight of 326.20 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19278178 |
| Molecular Formula | C12H16BrN5O |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 4-bromo-1-ethyl-N-methyl-N-[(2-methylpyrazol-3-yl)methyl]pyrazole-3-carboxamide |
| SMILES | CCn1cc(Br)c(C(=O)N(C)Cc2ccnn2C)n1 |
| InChI | InChI=1S/C12H16BrN5O/c1-4-18-8-10(13)11(15-18)12(19)16(2)7-9-5-6-14-17(9)3/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | MYYZOCIMPKZCGI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |