C12H15BrIN5O — CID 19277989
N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-4-iodo-N,1-dimethylpyrazole-3-carboxamide (PubChem CID 19277989) has the molecular formula C12H15BrIN5O and a molecular weight of 452.09 g/mol. Its IUPAC name is N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-4-iodo-N,1-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-4-iodo-N,1-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19277989 |
| Molecular Formula | C12H15BrIN5O |
| Molecular Weight | 452.09 g/mol |
| Exact Mass | 450.95 |
| IUPAC Name | N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-4-iodo-N,1-dimethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(Br)c(CN(C)C(=O)c2nn(C)cc2I)n1 |
| InChI | InChI=1S/C12H15BrIN5O/c1-4-19-5-8(13)10(15-19)7-17(2)12(20)11-9(14)6-18(3)16-11/h5-6H,4,7H2,1-3H3 |
| InChIKey | YDSUOXZUEYWSTP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.09 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|