C13H18IN5O — CID 19277979
4-iodo-N,1-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19277979) has the molecular formula C13H18IN5O and a molecular weight of 387.23 g/mol. Its IUPAC name is 4-iodo-N,1-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-iodo-N,1-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19277979 |
| Molecular Formula | C13H18IN5O |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 4-iodo-N,1-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1nn(C)c(C)c1CN(C)C(=O)c1nn(C)cc1I |
| InChI | InChI=1S/C13H18IN5O/c1-8-10(9(2)19(5)15-8)6-17(3)13(20)12-11(14)7-18(4)16-12/h7H,6H2,1-5H3 |
| InChIKey | ZWPCLHOEUDSVNL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|