C12H21ClN4O — CID 19456266
3-butyl-1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-1-methylurea (PubChem CID 19456266) has the molecular formula C12H21ClN4O and a molecular weight of 272.78 g/mol. Its IUPAC name is 3-butyl-1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-1-methylurea.
| Compound Name | 3-butyl-1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 19456266 |
| Molecular Formula | C12H21ClN4O |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-butyl-1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-1-methylurea |
| SMILES | CCCCNC(=O)N(C)Cc1nn(CC)cc1Cl |
| InChI | InChI=1S/C12H21ClN4O/c1-4-6-7-14-12(18)16(3)9-11-10(13)8-17(5-2)15-11/h8H,4-7,9H2,1-3H3,(H,14,18) |
| InChIKey | KJMOCXJRFGAMON-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|