C14H20ClN5O — CID 19558355
N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-N-methyl-3-(5-methylpyrazol-1-yl)propanamide (PubChem CID 19558355) has the molecular formula C14H20ClN5O and a molecular weight of 309.80 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-N-methyl-3-(5-methylpyrazol-1-yl)propanamide.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-N-methyl-3-(5-methylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19558355 |
| Molecular Formula | C14H20ClN5O |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-N-methyl-3-(5-methylpyrazol-1-yl)propanamide |
| SMILES | CCn1cc(Cl)c(CN(C)C(=O)CCn2nccc2C)n1 |
| InChI | InChI=1S/C14H20ClN5O/c1-4-19-9-12(15)13(17-19)10-18(3)14(21)6-8-20-11(2)5-7-16-20/h5,7,9H,4,6,8,10H2,1-3H3 |
| InChIKey | YOILSXBAIZPSOX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |