C14H19ClN6O4 — CID 19558433
N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-(3-methoxy-4-nitropyrazol-1-yl)-N-methylpropanamide (PubChem CID 19558433) has the molecular formula C14H19ClN6O4 and a molecular weight of 370.80 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-(3-methoxy-4-nitropyrazol-1-yl)-N-methylpropanamide.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-(3-methoxy-4-nitropyrazol-1-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 19558433 |
| Molecular Formula | C14H19ClN6O4 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-(3-methoxy-4-nitropyrazol-1-yl)-N-methylpropanamide |
| SMILES | CCn1cc(Cl)c(CN(C)C(=O)CCn2cc([N+](=O)[O-])c(OC)n2)n1 |
| InChI | InChI=1S/C14H19ClN6O4/c1-4-19-7-10(15)11(16-19)8-18(2)13(22)5-6-20-9-12(21(23)24)14(17-20)25-3/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | ZRHYHZISDDKYEB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 108.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|