C17H15Cl3N6O4 — CID 19558144
N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide (PubChem CID 19558144) has the molecular formula C17H15Cl3N6O4 and a molecular weight of 473.70 g/mol. Its IUPAC name is N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19558144 |
| Molecular Formula | C17H15Cl3N6O4 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | N-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
| SMILES | COc1nn(CCC(=O)Nc2nn(Cc3ccc(Cl)c(Cl)c3)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15Cl3N6O4/c1-30-17-14(26(28)29)9-24(23-17)5-4-15(27)21-16-13(20)8-25(22-16)7-10-2-3-11(18)12(19)6-10/h2-3,6,8-9H,4-5,7H2,1H3,(H,21,22,27) |
| InChIKey | HZCGFOZWUHQVDQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|