C17H17ClN6O5 — CID 19558234
N-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide (PubChem CID 19558234) has the molecular formula C17H17ClN6O5 and a molecular weight of 420.81 g/mol. Its IUPAC name is N-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19558234 |
| Molecular Formula | C17H17ClN6O5 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[1-[(3-chlorophenoxy)methyl]pyrazol-4-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
| SMILES | COc1nn(CCC(=O)Nc2cnn(COc3cccc(Cl)c3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17ClN6O5/c1-28-17-15(24(26)27)10-22(21-17)6-5-16(25)20-13-8-19-23(9-13)11-29-14-4-2-3-12(18)7-14/h2-4,7-10H,5-6,11H2,1H3,(H,20,25) |
| InChIKey | JDCPZUMNJKSNCV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|