C17H17FN6O4 — CID 19558197
N-[1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide (PubChem CID 19558197) has the molecular formula C17H17FN6O4 and a molecular weight of 388.36 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19558197 |
| Molecular Formula | C17H17FN6O4 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
| SMILES | COc1nn(CCC(=O)Nc2ccn(Cc3cccc(F)c3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17FN6O4/c1-28-17-14(24(26)27)11-23(21-17)8-6-16(25)19-15-5-7-22(20-15)10-12-3-2-4-13(18)9-12/h2-5,7,9,11H,6,8,10H2,1H3,(H,19,20,25) |
| InChIKey | IXLHQFZHKPOGAZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|