C15H16ClF3N4O — CID 19456269
1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-1-methyl-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 19456269) has the molecular formula C15H16ClF3N4O and a molecular weight of 360.77 g/mol. Its IUPAC name is 1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-1-methyl-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-1-methyl-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 19456269 |
| Molecular Formula | C15H16ClF3N4O |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-1-methyl-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCn1cc(Cl)c(CN(C)C(=O)Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H16ClF3N4O/c1-3-23-8-12(16)13(21-23)9-22(2)14(24)20-11-6-4-5-10(7-11)15(17,18)19/h4-8H,3,9H2,1-2H3,(H,20,24) |
| InChIKey | OMWDHQKAKZOZNB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |