C14H16F2N4OS — CID 19464840
3-[2-(difluoromethoxy)phenyl]-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]thiourea (PubChem CID 19464840) has the molecular formula C14H16F2N4OS and a molecular weight of 326.37 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)phenyl]-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 3-[2-(difluoromethoxy)phenyl]-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19464840 |
| Molecular Formula | C14H16F2N4OS |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-[2-(difluoromethoxy)phenyl]-1-methyl-1-[(2-methylpyrazol-3-yl)methyl]thiourea |
| SMILES | CN(Cc1ccnn1C)C(=S)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C14H16F2N4OS/c1-19(9-10-7-8-17-20(10)2)14(22)18-11-5-3-4-6-12(11)21-13(15)16/h3-8,13H,9H2,1-2H3,(H,18,22) |
| InChIKey | COCQVNIVWGJIAE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|