C15H18Cl2N4S — CID 2212322
1-(2,4-dichlorophenyl)-3-[(1R)-1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]thiourea (PubChem CID 2212322) has the molecular formula C15H18Cl2N4S and a molecular weight of 357.31 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[(1R)-1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[(1R)-1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 2212322 |
| Molecular Formula | C15H18Cl2N4S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[(1R)-1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]thiourea |
| SMILES | CCn1ncc([C@@H](C)NC(=S)Nc2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C15H18Cl2N4S/c1-4-21-10(3)12(8-18-21)9(2)19-15(22)20-14-6-5-11(16)7-13(14)17/h5-9H,4H2,1-3H3,(H2,19,20,22)/t9-/m1/s1 |
| InChIKey | YGRJKRFVXROVDA-SECBINFHSA-N |
| XLogP | 4.57 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|