C14H16Cl2N4S — CID 19469263
1-(2,4-dichlorophenyl)-3-[1-(1,3-dimethylpyrazol-4-yl)ethyl]thiourea (PubChem CID 19469263) has the molecular formula C14H16Cl2N4S and a molecular weight of 343.28 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[1-(1,3-dimethylpyrazol-4-yl)ethyl]thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[1-(1,3-dimethylpyrazol-4-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 19469263 |
| Molecular Formula | C14H16Cl2N4S |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[1-(1,3-dimethylpyrazol-4-yl)ethyl]thiourea |
| SMILES | Cc1nn(C)cc1C(C)NC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N4S/c1-8(11-7-20(3)19-9(11)2)17-14(21)18-13-5-4-10(15)6-12(13)16/h4-8H,1-3H3,(H2,17,18,21) |
| InChIKey | WMWNRVLWZNTLCY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|