C15H21ClN4O — CID 120624555
5-amino-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-2-methylbenzamide;hydrochloride (PubChem CID 120624555) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 5-amino-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-2-methylbenzamide;hydrochloride.
| Compound Name | 5-amino-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-2-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120624555 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-amino-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-2-methylbenzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)NC(C)c1cn(C)nc1C.Cl |
| InChI | InChI=1S/C15H20N4O.ClH/c1-9-5-6-12(16)7-13(9)15(20)17-10(2)14-8-19(4)18-11(14)3;/h5-8,10H,16H2,1-4H3,(H,17,20);1H |
| InChIKey | DPSDOZYLILUFNH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|