C14H19ClN4O — CID 119944858
2-amino-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]benzamide;hydrochloride (PubChem CID 119944858) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is 2-amino-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]benzamide;hydrochloride.
| Compound Name | 2-amino-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119944858 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-amino-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]benzamide;hydrochloride |
| SMILES | Cc1nn(C)cc1C(C)NC(=O)c1ccccc1N.Cl |
| InChI | InChI=1S/C14H18N4O.ClH/c1-9(12-8-18(3)17-10(12)2)16-14(19)11-6-4-5-7-13(11)15;/h4-9H,15H2,1-3H3,(H,16,19);1H |
| InChIKey | RDNNZELRQJZQAL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|