C14H17N3O2 — CID 79225808
2-amino-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]benzamide (PubChem CID 79225808) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-amino-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]benzamide.
| Compound Name | 2-amino-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 79225808 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-amino-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]benzamide |
| SMILES | Cc1noc(C)c1C(C)NC(=O)c1ccccc1N |
| InChI | InChI=1S/C14H17N3O2/c1-8(13-9(2)17-19-10(13)3)16-14(18)11-6-4-5-7-12(11)15/h4-8H,15H2,1-3H3,(H,16,18) |
| InChIKey | OVVPYKRBFJHLAZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|