C13H14BrN3O2 — CID 103755407
2-bromo-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]pyridine-3-carboxamide (PubChem CID 103755407) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 2-bromo-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-bromo-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103755407 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-bromo-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]pyridine-3-carboxamide |
| SMILES | Cc1noc(C)c1C(C)NC(=O)c1cccnc1Br |
| InChI | InChI=1S/C13H14BrN3O2/c1-7(11-8(2)17-19-9(11)3)16-13(18)10-5-4-6-15-12(10)14/h4-7H,1-3H3,(H,16,18) |
| InChIKey | RTHBXPJNJITCER-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|