C14H15IN2O2 — CID 78961175
N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-iodobenzamide (PubChem CID 78961175) has the molecular formula C14H15IN2O2 and a molecular weight of 370.19 g/mol. Its IUPAC name is N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-iodobenzamide.
| Compound Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 78961175 |
| Molecular Formula | C14H15IN2O2 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-iodobenzamide |
| SMILES | Cc1noc(C)c1C(C)NC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C14H15IN2O2/c1-8(13-9(2)17-19-10(13)3)16-14(18)11-5-4-6-12(15)7-11/h4-8H,1-3H3,(H,16,18) |
| InChIKey | JADGQSZTFPFWEU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|