C15H19N3O3 — CID 104783070
4-amino-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-methoxybenzamide (PubChem CID 104783070) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-amino-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-methoxybenzamide.
| Compound Name | 4-amino-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 104783070 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-amino-N-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC(C)c2c(C)noc2C)ccc1N |
| InChI | InChI=1S/C15H19N3O3/c1-8(14-9(2)18-21-10(14)3)17-15(19)11-5-6-12(16)13(7-11)20-4/h5-8H,16H2,1-4H3,(H,17,19) |
| InChIKey | DJLRRTOIVUMDEA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|