C13H16ClN3O — CID 107678355
2-chloro-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]phenol (PubChem CID 107678355) has the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. Its IUPAC name is 2-chloro-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]phenol.
| Compound Name | 2-chloro-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]phenol |
|---|---|
| PubChem CID | 107678355 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-chloro-4-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]phenol |
| SMILES | Cc1nn(C)cc1C(C)Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClN3O/c1-8(11-7-17(3)16-9(11)2)15-10-4-5-13(18)12(14)6-10/h4-8,15,18H,1-3H3 |
| InChIKey | FTCNYNJEZJPKKZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|