C15H18N4 — CID 65192008
N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-1H-indol-5-amine (PubChem CID 65192008) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-1H-indol-5-amine.
| Compound Name | N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-1H-indol-5-amine |
|---|---|
| PubChem CID | 65192008 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-1H-indol-5-amine |
| SMILES | Cc1nn(C)cc1C(C)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C15H18N4/c1-10(14-9-19(3)18-11(14)2)17-13-4-5-15-12(8-13)6-7-16-15/h4-10,16-17H,1-3H3 |
| InChIKey | XXUWMYAMAALARZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |