C13H16IN3 — CID 65192267
N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-4-iodoaniline (PubChem CID 65192267) has the molecular formula C13H16IN3 and a molecular weight of 341.20 g/mol. Its IUPAC name is N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-4-iodoaniline.
| Compound Name | N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-4-iodoaniline |
|---|---|
| PubChem CID | 65192267 |
| Molecular Formula | C13H16IN3 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-4-iodoaniline |
| SMILES | Cc1nn(C)cc1C(C)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C13H16IN3/c1-9(13-8-17(3)16-10(13)2)15-12-6-4-11(14)5-7-12/h4-9,15H,1-3H3 |
| InChIKey | NJOZNGCOBGEGSN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|