C18H20ClN5O — CID 19509481
3-(4-chlorophenyl)-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 19509481) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19509481 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[1-(1-ethyl-5-methylpyrazol-4-yl)ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | CCn1ncc(C(C)NC(=O)c2cc(-c3ccc(Cl)cc3)n[nH]2)c1C |
| InChI | InChI=1S/C18H20ClN5O/c1-4-24-12(3)15(10-20-24)11(2)21-18(25)17-9-16(22-23-17)13-5-7-14(19)8-6-13/h5-11H,4H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | BPYNQCWJMNIXSR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |