C16H14ClFN6O — CID 124855794
3-(4-chlorophenyl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 124855794) has the molecular formula C16H14ClFN6O and a molecular weight of 360.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 124855794 |
| Molecular Formula | C16H14ClFN6O |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[(Z)-(1-ethyl-5-fluoropyrazol-4-yl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | CCn1ncc(/C=N\NC(=O)c2cc(-c3ccc(Cl)cc3)n[nH]2)c1F |
| InChI | InChI=1S/C16H14ClFN6O/c1-2-24-15(18)11(9-20-24)8-19-23-16(25)14-7-13(21-22-14)10-3-5-12(17)6-4-10/h3-9H,2H2,1H3,(H,21,22)(H,23,25)/b19-8- |
| InChIKey | ZOUGBBDKDPZIBK-UWVJOHFNSA-N |
| XLogP | 2.85 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|