C18H20Cl2N6S — CID 19456094
1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-1-methylthiourea (PubChem CID 19456094) has the molecular formula C18H20Cl2N6S and a molecular weight of 423.37 g/mol. Its IUPAC name is 1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-1-methylthiourea.
| Compound Name | 1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-1-methylthiourea |
|---|---|
| PubChem CID | 19456094 |
| Molecular Formula | C18H20Cl2N6S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 1-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-1-methylthiourea |
| SMILES | CCn1cc(Cl)c(CN(C)C(=S)Nc2cnn(Cc3cccc(Cl)c3)c2)n1 |
| InChI | InChI=1S/C18H20Cl2N6S/c1-3-25-11-16(20)17(23-25)12-24(2)18(27)22-15-8-21-26(10-15)9-13-5-4-6-14(19)7-13/h4-8,10-11H,3,9,12H2,1-2H3,(H,22,27) |
| InChIKey | VYEFKNVABZLBGW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|