C17H19BrN6S — CID 19572053
1-(1-benzylpyrazol-4-yl)-3-[(4-bromo-1-ethylpyrazol-3-yl)methyl]thiourea (PubChem CID 19572053) has the molecular formula C17H19BrN6S and a molecular weight of 419.35 g/mol. Its IUPAC name is 1-(1-benzylpyrazol-4-yl)-3-[(4-bromo-1-ethylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 1-(1-benzylpyrazol-4-yl)-3-[(4-bromo-1-ethylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19572053 |
| Molecular Formula | C17H19BrN6S |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 1-(1-benzylpyrazol-4-yl)-3-[(4-bromo-1-ethylpyrazol-3-yl)methyl]thiourea |
| SMILES | CCn1cc(Br)c(CNC(=S)Nc2cnn(Cc3ccccc3)c2)n1 |
| InChI | InChI=1S/C17H19BrN6S/c1-2-23-12-15(18)16(22-23)9-19-17(25)21-14-8-20-24(11-14)10-13-6-4-3-5-7-13/h3-8,11-12H,2,9-10H2,1H3,(H2,19,21,25) |
| InChIKey | BLSOWYKQMMSUDQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|