C13H13BrClFN4S — CID 19572008
1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(3-chloro-4-fluorophenyl)thiourea (PubChem CID 19572008) has the molecular formula C13H13BrClFN4S and a molecular weight of 391.70 g/mol. Its IUPAC name is 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(3-chloro-4-fluorophenyl)thiourea.
| Compound Name | 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(3-chloro-4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 19572008 |
| Molecular Formula | C13H13BrClFN4S |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(3-chloro-4-fluorophenyl)thiourea |
| SMILES | CCn1cc(Br)c(CNC(=S)Nc2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H13BrClFN4S/c1-2-20-7-9(14)12(19-20)6-17-13(21)18-8-3-4-11(16)10(15)5-8/h3-5,7H,2,6H2,1H3,(H2,17,18,21) |
| InChIKey | CMJNCOGLXNNWIW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|