C13H13BrCl2N4S — CID 19572007
1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(2,5-dichlorophenyl)thiourea (PubChem CID 19572007) has the molecular formula C13H13BrCl2N4S and a molecular weight of 408.15 g/mol. Its IUPAC name is 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(2,5-dichlorophenyl)thiourea.
| Compound Name | 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(2,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 19572007 |
| Molecular Formula | C13H13BrCl2N4S |
| Molecular Weight | 408.15 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | 1-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-(2,5-dichlorophenyl)thiourea |
| SMILES | CCn1cc(Br)c(CNC(=S)Nc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C13H13BrCl2N4S/c1-2-20-7-9(14)12(19-20)6-17-13(21)18-11-5-8(15)3-4-10(11)16/h3-5,7H,2,6H2,1H3,(H2,17,18,21) |
| InChIKey | POERMVKDWSBAMZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.15 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|