C16H17BrClN3O — CID 19333183
N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-2-(4-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 19333183) has the molecular formula C16H17BrClN3O and a molecular weight of 382.69 g/mol. Its IUPAC name is N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-2-(4-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-2-(4-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 19333183 |
| Molecular Formula | C16H17BrClN3O |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-2-(4-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CCn1cc(Br)c(CNC(=O)C2CC2c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H17BrClN3O/c1-2-21-9-14(17)15(20-21)8-19-16(22)13-7-12(13)10-3-5-11(18)6-4-10/h3-6,9,12-13H,2,7-8H2,1H3,(H,19,22) |
| InChIKey | JWOYOJWEUGGWCW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |