C15H16N6S — CID 19401642
1-(1-benzylpyrazol-4-yl)-3-(1-methylpyrazol-3-yl)thiourea (PubChem CID 19401642) has the molecular formula C15H16N6S and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-(1-benzylpyrazol-4-yl)-3-(1-methylpyrazol-3-yl)thiourea.
| Compound Name | 1-(1-benzylpyrazol-4-yl)-3-(1-methylpyrazol-3-yl)thiourea |
|---|---|
| PubChem CID | 19401642 |
| Molecular Formula | C15H16N6S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-(1-benzylpyrazol-4-yl)-3-(1-methylpyrazol-3-yl)thiourea |
| SMILES | Cn1ccc(NC(=S)Nc2cnn(Cc3ccccc3)c2)n1 |
| InChI | InChI=1S/C15H16N6S/c1-20-8-7-14(19-20)18-15(22)17-13-9-16-21(11-13)10-12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H2,17,18,19,22) |
| InChIKey | GQDITWTXDVNPMZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|