C18H20Cl2N2S2 — CID 100598919
1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 100598919) has the molecular formula C18H20Cl2N2S2 and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 100598919 |
| Molecular Formula | C18H20Cl2N2S2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCSCc2ccc(Cl)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C18H20Cl2N2S2/c1-12-3-6-17(13(2)9-12)22-18(23)21-7-8-24-11-14-4-5-15(19)16(20)10-14/h3-6,9-10H,7-8,11H2,1-2H3,(H2,21,22,23) |
| InChIKey | PFKKOTIKWAHCJP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|