C16H14FN3S2 — CID 9097337
1-(1,3-benzothiazol-2-ylmethyl)-3-(2-fluorophenyl)-1-methylthiourea (PubChem CID 9097337) has the molecular formula C16H14FN3S2 and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-3-(2-fluorophenyl)-1-methylthiourea.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-(2-fluorophenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 9097337 |
| Molecular Formula | C16H14FN3S2 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-3-(2-fluorophenyl)-1-methylthiourea |
| SMILES | CN(Cc1nc2ccccc2s1)C(=S)Nc1ccccc1F |
| InChI | InChI=1S/C16H14FN3S2/c1-20(16(21)19-12-7-3-2-6-11(12)17)10-15-18-13-8-4-5-9-14(13)22-15/h2-9H,10H2,1H3,(H,19,21) |
| InChIKey | UILZXQJLOGWKLU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|