C16H11Cl2FN2OS — CID 41440557
N-(1,3-benzothiazol-2-ylmethyl)-2,4-dichloro-5-fluoro-N-methylbenzamide (PubChem CID 41440557) has the molecular formula C16H11Cl2FN2OS and a molecular weight of 369.25 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2,4-dichloro-5-fluoro-N-methylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2,4-dichloro-5-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 41440557 |
| Molecular Formula | C16H11Cl2FN2OS |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2,4-dichloro-5-fluoro-N-methylbenzamide |
| SMILES | CN(Cc1nc2ccccc2s1)C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl2FN2OS/c1-21(8-15-20-13-4-2-3-5-14(13)23-15)16(22)9-6-12(19)11(18)7-10(9)17/h2-7H,8H2,1H3 |
| InChIKey | FSHLRSRCLHIDDP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|