C15H12BrN3OS — CID 103752006
N-(1,3-benzothiazol-2-ylmethyl)-2-bromo-N-methylpyridine-3-carboxamide (PubChem CID 103752006) has the molecular formula C15H12BrN3OS and a molecular weight of 362.25 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2-bromo-N-methylpyridine-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2-bromo-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 103752006 |
| Molecular Formula | C15H12BrN3OS |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2-bromo-N-methylpyridine-3-carboxamide |
| SMILES | CN(Cc1nc2ccccc2s1)C(=O)c1cccnc1Br |
| InChI | InChI=1S/C15H12BrN3OS/c1-19(15(20)10-5-4-8-17-14(10)16)9-13-18-11-6-2-3-7-12(11)21-13/h2-8H,9H2,1H3 |
| InChIKey | WGBSCMOREAMFGZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|